C27H31N2+ — CID 157269895
2',7'-dimethyl-8'-[1-methyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium-2-yl]spiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] (PubChem CID 157269895) has the molecular formula C27H31N2+ and a molecular weight of 387.58 g/mol. Its IUPAC name is 2',7'-dimethyl-8'-[1-methyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium-2-yl]spiro[cyclopentane-1,9'-indeno[2,1-b]pyridine].
| Compound Name | 2',7'-dimethyl-8'-[1-methyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium-2-yl]spiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] |
|---|---|
| PubChem CID | 157269895 |
| Molecular Formula | C27H31N2+ |
| Molecular Weight | 387.58 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 2',7'-dimethyl-8'-[1-methyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium-2-yl]spiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1cc[n+](C)c(-c2c(C)ccc3c2C2(CCCC2)c2nc(C)ccc2-3)c1 |
| InChI | InChI=1S/C27H31N2/c1-17(2)20-12-15-29(5)23(16-20)24-18(3)8-10-21-22-11-9-19(4)28-26(22)27(25(21)24)13-6-7-14-27/h8-12,15-17H,6-7,13-14H2,1-5H3/q+1/i1D3,17D |
| InChIKey | CFLJXLIWPYTPNW-LCJPYDMBSA-N |
| XLogP | 6.15 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|