C15H10F9O3PS — CID 159279842
bis[4-(trifluoromethyl)phenyl]phosphanium;trifluoromethanesulfonate (PubChem CID 159279842) has the molecular formula C15H10F9O3PS and a molecular weight of 472.27 g/mol. Its IUPAC name is bis[4-(trifluoromethyl)phenyl]phosphanium;trifluoromethanesulfonate.
| Compound Name | bis[4-(trifluoromethyl)phenyl]phosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159279842 |
| Molecular Formula | C15H10F9O3PS |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | bis[4-(trifluoromethyl)phenyl]phosphanium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)c1ccc([PH2+]c2ccc(C(F)(F)F)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H9F6P.CHF3O3S/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20;2-1(3,4)8(5,6)7/h1-8,21H;(H,5,6,7) |
| InChIKey | KYTSWDMQWIGYDQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|