C39H40O9 — CID 159281106
diethyl 2-oxo-3-(3-phenylmethoxyphenyl)butanedioate;ethyl 2-(3-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 159281106) has the molecular formula C39H40O9 and a molecular weight of 652.74 g/mol. Its IUPAC name is diethyl 2-oxo-3-(3-phenylmethoxyphenyl)butanedioate;ethyl 2-(3-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | diethyl 2-oxo-3-(3-phenylmethoxyphenyl)butanedioate;ethyl 2-(3-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 159281106 |
| Molecular Formula | C39H40O9 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | diethyl 2-oxo-3-(3-phenylmethoxyphenyl)butanedioate;ethyl 2-(3-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCC)c1cccc(OCc2ccccc2)c1.CCOC(=O)C(=O)C(C(=O)OCC)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22O6.C18H18O3/c1-3-25-20(23)18(19(22)21(24)26-4-2)16-11-8-12-17(13-16)27-14-15-9-6-5-7-10-15;1-3-20-18(19)14(2)16-10-7-11-17(12-16)21-13-15-8-5-4-6-9-15/h5-13,18H,3-4,14H2,1-2H3;4-12H,2-3,13H2,1H3 |
| InChIKey | KYXUPJDCWFZHGN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|