C50H51F3O6S — CID 159281385
trifluoromethanesulfonic acid;2,3,4-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene (PubChem CID 159281385) has the molecular formula C50H51F3O6S and a molecular weight of 837.01 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;2,3,4-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene.
| Compound Name | trifluoromethanesulfonic acid;2,3,4-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene |
|---|---|
| PubChem CID | 159281385 |
| Molecular Formula | C50H51F3O6S |
| Molecular Weight | 837.01 g/mol |
| Exact Mass | 836.34 |
| IUPAC Name | trifluoromethanesulfonic acid;2,3,4-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene |
| SMILES | CC(C)(C)Oc1ccc(-c2c(-c3ccccc3)c3c(c(-c4ccc(OC(C)(C)C)cc4)c2-c2ccc(OC(C)(C)C)cc2)-c2ccccc2C3)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C49H50O3.CHF3O3S/c1-47(2,3)50-37-25-19-33(20-26-37)43-42(32-15-11-10-12-16-32)41-31-36-17-13-14-18-40(36)46(41)45(35-23-29-39(30-24-35)52-49(7,8)9)44(43)34-21-27-38(28-22-34)51-48(4,5)6;2-1(3,4)8(5,6)7/h10-30H,31H2,1-9H3;(H,5,6,7) |
| InChIKey | KYYQXAPWJLIQLT-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.01 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|