C26H30F3N6O5- — CID 159284093
N-[(2R)-3,3-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]butan-2-yl]-N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate (PubChem CID 159284093) has the molecular formula C26H30F3N6O5- and a molecular weight of 563.56 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]butan-2-yl]-N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate.
| Compound Name | N-[(2R)-3,3-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]butan-2-yl]-N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 159284093 |
| Molecular Formula | C26H30F3N6O5- |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | N-[(2R)-3,3-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]butan-2-yl]-N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
| SMILES | CCCC[C@@H](C(=O)C(=O)Nc1ccn[nH]1)N(C(=O)[O-])[C@H](Cc1nnc(-c2ccc(C(F)(F)F)cc2)o1)C(C)(C)C |
| InChI | InChI=1S/C26H31F3N6O5/c1-5-6-7-17(21(36)22(37)31-19-12-13-30-32-19)35(24(38)39)18(25(2,3)4)14-20-33-34-23(40-20)15-8-10-16(11-9-15)26(27,28)29/h8-13,17-18H,5-7,14H2,1-4H3,(H,38,39)(H2,30,31,32,37)/p-1/t17-,18+/m0/s1 |
| InChIKey | KZHCTMZOSDMUEL-ZWKOTPCHSA-M |
| XLogP | 3.85 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|