C28H30F3N3O3 — CID 159284157
N-[4-[4-[(S)-hydroxy(phenyl)methyl]cyclohexyl]-4-oxobutyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 159284157) has the molecular formula C28H30F3N3O3 and a molecular weight of 513.56 g/mol. Its IUPAC name is N-[4-[4-[(S)-hydroxy(phenyl)methyl]cyclohexyl]-4-oxobutyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-[4-[(S)-hydroxy(phenyl)methyl]cyclohexyl]-4-oxobutyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159284157 |
| Molecular Formula | C28H30F3N3O3 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N-[4-[4-[(S)-hydroxy(phenyl)methyl]cyclohexyl]-4-oxobutyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCCC(=O)C1CCC([C@H](O)c2ccccc2)CC1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C28H30F3N3O3/c29-28(30,31)26-23(18-34(33-26)22-10-5-2-6-11-22)27(37)32-17-7-12-24(35)19-13-15-21(16-14-19)25(36)20-8-3-1-4-9-20/h1-6,8-11,18-19,21,25,36H,7,12-17H2,(H,32,37)/t19?,21?,25-/m1/s1 |
| InChIKey | BZOVAZNMKPDLNJ-BPOAOHNVSA-N |
| XLogP | 5.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|