C23H29F3N4O4S — CID 158858702
N-[4-oxo-4-(4-propylsulfonylpiperidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 158858702) has the molecular formula C23H29F3N4O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is N-[4-oxo-4-(4-propylsulfonylpiperidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-oxo-4-(4-propylsulfonylpiperidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158858702 |
| Molecular Formula | C23H29F3N4O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[4-oxo-4-(4-propylsulfonylpiperidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCCS(=O)(=O)C1CCN(C(=O)CCCNC(=O)c2cn(-c3ccccc3)nc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H29F3N4O4S/c1-2-15-35(33,34)18-10-13-29(14-11-18)20(31)9-6-12-27-22(32)19-16-30(17-7-4-3-5-8-17)28-21(19)23(24,25)26/h3-5,7-8,16,18H,2,6,9-15H2,1H3,(H,27,32) |
| InChIKey | JAJREIDAGUITTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|