C24H24F3N5O2 — CID 160718695
N-[4-oxo-4-(3-pyridin-3-ylpyrrolidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 160718695) has the molecular formula C24H24F3N5O2 and a molecular weight of 471.48 g/mol. Its IUPAC name is N-[4-oxo-4-(3-pyridin-3-ylpyrrolidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-oxo-4-(3-pyridin-3-ylpyrrolidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 160718695 |
| Molecular Formula | C24H24F3N5O2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[4-oxo-4-(3-pyridin-3-ylpyrrolidin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCC(c2cccnc2)C1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C24H24F3N5O2/c25-24(26,27)22-20(16-32(30-22)19-7-2-1-3-8-19)23(34)29-12-5-9-21(33)31-13-10-18(15-31)17-6-4-11-28-14-17/h1-4,6-8,11,14,16,18H,5,9-10,12-13,15H2,(H,29,34) |
| InChIKey | RSUTWIWNWWEIHA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|