C30H29F3N4O3 — CID 159850667
N-[4-oxo-4-[4-(2-phenyl-1,3-oxazol-5-yl)cyclohexyl]butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 159850667) has the molecular formula C30H29F3N4O3 and a molecular weight of 550.58 g/mol. Its IUPAC name is N-[4-oxo-4-[4-(2-phenyl-1,3-oxazol-5-yl)cyclohexyl]butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-oxo-4-[4-(2-phenyl-1,3-oxazol-5-yl)cyclohexyl]butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159850667 |
| Molecular Formula | C30H29F3N4O3 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[4-oxo-4-[4-(2-phenyl-1,3-oxazol-5-yl)cyclohexyl]butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCCC(=O)C1CCC(c2cnc(-c3ccccc3)o2)CC1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C30H29F3N4O3/c31-30(32,33)27-24(19-37(36-27)23-10-5-2-6-11-23)28(39)34-17-7-12-25(38)20-13-15-21(16-14-20)26-18-35-29(40-26)22-8-3-1-4-9-22/h1-6,8-11,18-21H,7,12-17H2,(H,34,39) |
| InChIKey | ODYZRDCRYNZWPM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|