C24H25F3N6O2 — CID 161431236
N-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 161431236) has the molecular formula C24H25F3N6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 161431236 |
| Molecular Formula | C24H25F3N6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | N-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(c2ccccn2)CC1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N6O2/c25-24(26,27)22-19(17-33(30-22)18-7-2-1-3-8-18)23(35)29-12-6-10-21(34)32-15-13-31(14-16-32)20-9-4-5-11-28-20/h1-5,7-9,11,17H,6,10,12-16H2,(H,29,35) |
| InChIKey | VYAREQGSCMKIJY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|