C20H17BrF2N2O8 — CID 159284489
1-bromo-3-fluoro-5-nitrobenzene;methyl (E)-3-(3-fluoro-5-nitrophenyl)prop-2-enoate;methyl prop-2-enoate (PubChem CID 159284489) has the molecular formula C20H17BrF2N2O8 and a molecular weight of 531.26 g/mol. Its IUPAC name is 1-bromo-3-fluoro-5-nitrobenzene;methyl (E)-3-(3-fluoro-5-nitrophenyl)prop-2-enoate;methyl prop-2-enoate.
| Compound Name | 1-bromo-3-fluoro-5-nitrobenzene;methyl (E)-3-(3-fluoro-5-nitrophenyl)prop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 159284489 |
| Molecular Formula | C20H17BrF2N2O8 |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 1-bromo-3-fluoro-5-nitrobenzene;methyl (E)-3-(3-fluoro-5-nitrophenyl)prop-2-enoate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.COC(=O)/C=C/c1cc(F)cc([N+](=O)[O-])c1.O=[N+]([O-])c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C10H8FNO4.C6H3BrFNO2.C4H6O2/c1-16-10(13)3-2-7-4-8(11)6-9(5-7)12(14)15;7-4-1-5(8)3-6(2-4)9(10)11;1-3-4(5)6-2/h2-6H,1H3;1-3H;3H,1H2,2H3/b3-2+;; |
| InChIKey | KZIJUDJDUQKRTJ-WTVBWJGASA-N |
| XLogP | 4.76 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|