About carbon dioxide;1-methylimidazol-2-amine
carbon dioxide;1-methylimidazol-2-amine (PubChem CID 159291040) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is carbon dioxide;1-methylimidazol-2-amine.
Molecular Properties
| Compound Name | carbon dioxide;1-methylimidazol-2-amine |
| PubChem CID | 159291040 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | carbon dioxide;1-methylimidazol-2-amine |
| SMILES | Cn1ccnc1N.O=C=O |
| InChI | InChI=1S/C4H7N3.CO2/c1-7-3-2-6-4(7)5;2-1-3/h2-3H,1H3,(H2,5,6); |
| InChIKey | LACWCHOFZVIILL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;1-methylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-methylimidazol-2-amine?
The IUPAC name of carbon dioxide;1-methylimidazol-2-amine (CID 159291040) is carbon dioxide;1-methylimidazol-2-amine.
What is the SMILES notation for carbon dioxide;1-methylimidazol-2-amine?
The canonical SMILES for carbon dioxide;1-methylimidazol-2-amine is Cn1ccnc1N.O=C=O.
What is the InChIKey of carbon dioxide;1-methylimidazol-2-amine?
The InChIKey is LACWCHOFZVIILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3.CO2/c1-7-3-2-6-4(7)5;2-1-3/h2-3H,1H3,(H2,5,6);.
What are the key properties of carbon dioxide;1-methylimidazol-2-amine?
carbon dioxide;1-methylimidazol-2-amine has a molecular weight of 141.13 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-methylimidazol-2-amine is sourced from PubChem (CID 159291040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).