C14H19N12O4S2+ — CID 159291810
(5-carbamoyl-1H-imidazol-4-yl)iminoazanium;isocyanato(methylsulfanyl)methane;3-(methylsulfanylmethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 159291810) has the molecular formula C14H19N12O4S2+ and a molecular weight of 483.52 g/mol. Its IUPAC name is (5-carbamoyl-1H-imidazol-4-yl)iminoazanium;isocyanato(methylsulfanyl)methane;3-(methylsulfanylmethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | (5-carbamoyl-1H-imidazol-4-yl)iminoazanium;isocyanato(methylsulfanyl)methane;3-(methylsulfanylmethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 159291810 |
| Molecular Formula | C14H19N12O4S2+ |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (5-carbamoyl-1H-imidazol-4-yl)iminoazanium;isocyanato(methylsulfanyl)methane;3-(methylsulfanylmethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | CSCN=C=O.CSCn1nnc2c(C(N)=O)ncn2c1=O.NC(=O)c1[nH]cnc1N=[NH2+] |
| InChI | InChI=1S/C7H8N6O2S.C4H5N5O.C3H5NOS/c1-16-3-13-7(15)12-2-9-4(5(8)14)6(12)10-11-13;5-3(10)2-4(9-6)8-1-7-2;1-6-3-4-2-5/h2H,3H2,1H3,(H2,8,14);1,6H,(H2,5,10)(H,7,8);3H2,1H3/p+1 |
| InChIKey | LAFKEVYCVGOGBW-UHFFFAOYSA-O |
| XLogP | -2.30 |
| TPSA | 247.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|