About bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+)
bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) (PubChem CID 159293471) has the molecular formula C25H22SiTi
and a molecular weight of 398.40 g/mol. Its IUPAC name is bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+).
Molecular Properties
| Compound Name | bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) |
| PubChem CID | 159293471 |
| Molecular Formula | C25H22SiTi |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) |
| SMILES | C[Si](=[Ti+2])c1ccccc1.c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/2C9H7.C7H8Si.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;1-8-7-5-3-2-4-6-7;/h2*1-7H;2-6H,1H3;/q2*-1;;+2 |
| InChIKey | HVWHSZXRFKGPTI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+)?
The IUPAC name of bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) (CID 159293471) is bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+).
What is the SMILES notation for bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+)?
The canonical SMILES for bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) is C[Si](=[Ti+2])c1ccccc1.c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1.
What is the InChIKey of bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+)?
The InChIKey is HVWHSZXRFKGPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7.C7H8Si.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;1-8-7-5-3-2-4-6-7;/h2*1-7H;2-6H,1H3;/q2*-1;;+2.
What are the key properties of bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+)?
bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) has a molecular weight of 398.40 g/mol, XLogP of 6.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-inden-1-ide);[methyl(phenyl)silylidene]titanium(2+) is sourced from PubChem (CID 159293471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).