C20H20O7S — CID 159295328
dimethyl 5-(4-methylphenoxy)-4-prop-2-enylbenzene-1,3-dicarboxylate;sulfur dioxide (PubChem CID 159295328) has the molecular formula C20H20O7S and a molecular weight of 404.44 g/mol. Its IUPAC name is dimethyl 5-(4-methylphenoxy)-4-prop-2-enylbenzene-1,3-dicarboxylate;sulfur dioxide.
| Compound Name | dimethyl 5-(4-methylphenoxy)-4-prop-2-enylbenzene-1,3-dicarboxylate;sulfur dioxide |
|---|---|
| PubChem CID | 159295328 |
| Molecular Formula | C20H20O7S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | dimethyl 5-(4-methylphenoxy)-4-prop-2-enylbenzene-1,3-dicarboxylate;sulfur dioxide |
| SMILES | C=CCc1c(Oc2ccc(C)cc2)cc(C(=O)OC)cc1C(=O)OC.O=S=O |
| InChI | InChI=1S/C20H20O5.O2S/c1-5-6-16-17(20(22)24-4)11-14(19(21)23-3)12-18(16)25-15-9-7-13(2)8-10-15;1-3-2/h5,7-12H,1,6H2,2-4H3; |
| InChIKey | LAQIDJFDGCUSLX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|