C12H23ClPtS2 — CID 159299942
chloroplatinum(1+);methylsulfanylmethane;2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiolate (PubChem CID 159299942) has the molecular formula C12H23ClPtS2 and a molecular weight of 461.98 g/mol. Its IUPAC name is chloroplatinum(1+);methylsulfanylmethane;2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiolate.
| Compound Name | chloroplatinum(1+);methylsulfanylmethane;2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiolate |
|---|---|
| PubChem CID | 159299942 |
| Molecular Formula | C12H23ClPtS2 |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | chloroplatinum(1+);methylsulfanylmethane;2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiolate |
| SMILES | CC1CCC2CC1([S-])C2(C)C.CSC.Cl[Pt+] |
| InChI | InChI=1S/C10H18S.C2H6S.ClH.Pt/c1-7-4-5-8-6-10(7,11)9(8,2)3;1-3-2;;/h7-8,11H,4-6H2,1-3H3;1-2H3;1H;/q;;;+2/p-2 |
| InChIKey | LBEZJAQZXZHOKS-UHFFFAOYSA-L |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|