C20H34O — CID 71499837
(1R,4S,5S,8S,10S,13R,14R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol (PubChem CID 71499837) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (1R,4S,5S,8S,10S,13R,14R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol.
| Compound Name | (1R,4S,5S,8S,10S,13R,14R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol |
|---|---|
| PubChem CID | 71499837 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (1R,4S,5S,8S,10S,13R,14R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol |
| SMILES | C[C@@H]1CC[C@H]2C[C@]3(C)CC[C@H]4[C@H]3[C@]1(CC[C@]4(C)O)C2(C)C |
| InChI | InChI=1S/C20H34O/c1-13-6-7-14-12-18(4)9-8-15-16(18)20(13,17(14,2)3)11-10-19(15,5)21/h13-16,21H,6-12H2,1-5H3/t13-,14+,15+,16-,18+,19+,20-/m1/s1 |
| InChIKey | RLFWGQVIKYIGGM-VBXVDEENSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |