C30H50 — CID 154444877
2,6,6-trimethyl-1-[(1S)-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl]-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)bicyclo[3.1.1]heptane (PubChem CID 154444877) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[(1S)-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl]-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)bicyclo[3.1.1]heptane.
| Compound Name | 2,6,6-trimethyl-1-[(1S)-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl]-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)bicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 154444877 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 2,6,6-trimethyl-1-[(1S)-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl]-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)bicyclo[3.1.1]heptane |
| SMILES | CC1CCC2CC1(C1(C)CCC3CC1([C@@]14CC(CCC1C)C4(C)C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C30H50/c1-19-10-12-21-16-28(19,24(21,3)4)27(9)15-14-23-18-30(27,26(23,7)8)29-17-22(25(29,5)6)13-11-20(29)2/h19-23H,10-18H2,1-9H3/t19?,20?,21?,22?,23?,27?,28?,29-,30?/m0/s1 |
| InChIKey | KZMWWGNGEMODTC-JFADFBATSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |