C11H18 — CID 159302327
2,6-diethylbicyclo[3.2.0]hept-1(5)-ene (PubChem CID 159302327) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is 2,6-diethylbicyclo[3.2.0]hept-1(5)-ene.
| Compound Name | 2,6-diethylbicyclo[3.2.0]hept-1(5)-ene |
|---|---|
| PubChem CID | 159302327 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 2,6-diethylbicyclo[3.2.0]hept-1(5)-ene |
| SMILES | CCC1CCC2=C1CC2CC |
| InChI | InChI=1S/C11H18/c1-3-8-5-6-10-9(4-2)7-11(8)10/h8-9H,3-7H2,1-2H3 |
| InChIKey | LBMKBMBGMGPNIM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|