C20H38N2O4 — CID 159306009
2-(butylamino)ethyl 2-methylprop-2-enoate;5-(tert-butylamino)-2-methylpent-2-enoic acid (PubChem CID 159306009) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-(butylamino)ethyl 2-methylprop-2-enoate;5-(tert-butylamino)-2-methylpent-2-enoic acid.
| Compound Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;5-(tert-butylamino)-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 159306009 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;5-(tert-butylamino)-2-methylpent-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCNCCCC.CC(=CCCNC(C)(C)C)C(=O)O |
| InChI | InChI=1S/2C10H19NO2/c1-8(9(12)13)6-5-7-11-10(2,3)4;1-4-5-6-11-7-8-13-10(12)9(2)3/h6,11H,5,7H2,1-4H3,(H,12,13);11H,2,4-8H2,1,3H3 |
| InChIKey | LBXSMDTVUOVMQV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|