C33H27Cl2F2N5O4 — CID 159309322
4-[12-(3,4-dichlorobenzoyl)-5-[2-[4-(difluoromethoxy)phenyl]ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 159309322) has the molecular formula C33H27Cl2F2N5O4 and a molecular weight of 666.51 g/mol. Its IUPAC name is 4-[12-(3,4-dichlorobenzoyl)-5-[2-[4-(difluoromethoxy)phenyl]ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(3,4-dichlorobenzoyl)-5-[2-[4-(difluoromethoxy)phenyl]ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 159309322 |
| Molecular Formula | C33H27Cl2F2N5O4 |
| Molecular Weight | 666.51 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | 4-[12-(3,4-dichlorobenzoyl)-5-[2-[4-(difluoromethoxy)phenyl]ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(CCc5ccc(OC(F)F)cc5)c24)CN(C(=O)c2ccc(Cl)c(Cl)c2)CC3)cc1 |
| InChI | InChI=1S/C33H27Cl2F2N5O4/c1-38-29(43)20-6-9-23(10-7-20)41-30-22(5-2-19-3-11-24(12-4-19)46-33(36)37)17-39-42(30)28-18-40(15-14-25(28)32(41)45)31(44)21-8-13-26(34)27(35)16-21/h3-4,6-13,16-17,33H,2,5,14-15,18H2,1H3,(H,38,43) |
| InChIKey | LCIHRTDFMQZAJV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |