C14H23F2NO2SSi — CID 159311324
4-(difluoromethylsulfonyl)-N-methyl-N-(3-propylsilylpropyl)aniline (PubChem CID 159311324) has the molecular formula C14H23F2NO2SSi and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-methyl-N-(3-propylsilylpropyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-methyl-N-(3-propylsilylpropyl)aniline |
|---|---|
| PubChem CID | 159311324 |
| Molecular Formula | C14H23F2NO2SSi |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-methyl-N-(3-propylsilylpropyl)aniline |
| SMILES | CCC[SiH2]CCCN(C)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H23F2NO2SSi/c1-3-10-21-11-4-9-17(2)12-5-7-13(8-6-12)20(18,19)14(15)16/h5-8,14H,3-4,9-11,21H2,1-2H3 |
| InChIKey | SCQZQKOLGXKKEF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|