C10H13F2NO3S — CID 61146533
2-[4-(difluoromethylsulfonyl)-N-methylanilino]ethanol (PubChem CID 61146533) has the molecular formula C10H13F2NO3S and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)-N-methylanilino]ethanol.
| Compound Name | 2-[4-(difluoromethylsulfonyl)-N-methylanilino]ethanol |
|---|---|
| PubChem CID | 61146533 |
| Molecular Formula | C10H13F2NO3S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)-N-methylanilino]ethanol |
| SMILES | CN(CCO)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C10H13F2NO3S/c1-13(6-7-14)8-2-4-9(5-3-8)17(15,16)10(11)12/h2-5,10,14H,6-7H2,1H3 |
| InChIKey | ARTCQEZSDQYXNJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |