C54H42BBr3N4O2 — CID 159317447
2-(4-bromonaphthalen-1-yl)-4-phenylquinazoline;1,4-dibromonaphthalene;4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (PubChem CID 159317447) has the molecular formula C54H42BBr3N4O2 and a molecular weight of 1029.48 g/mol. Its IUPAC name is 2-(4-bromonaphthalen-1-yl)-4-phenylquinazoline;1,4-dibromonaphthalene;4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline.
| Compound Name | 2-(4-bromonaphthalen-1-yl)-4-phenylquinazoline;1,4-dibromonaphthalene;4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
|---|---|
| PubChem CID | 159317447 |
| Molecular Formula | C54H42BBr3N4O2 |
| Molecular Weight | 1029.48 g/mol |
| Exact Mass | 1026.10 |
| IUPAC Name | 2-(4-bromonaphthalen-1-yl)-4-phenylquinazoline;1,4-dibromonaphthalene;4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
| SMILES | Brc1ccc(-c2nc(-c3ccccc3)c3ccccc3n2)c2ccccc12.Brc1ccc(Br)c2ccccc12.CC1(C)OB(c2nc(-c3ccccc3)c3ccccc3n2)OC1(C)C |
| InChI | InChI=1S/C24H15BrN2.C20H21BN2O2.C10H6Br2/c25-21-15-14-19(17-10-4-5-11-18(17)21)24-26-22-13-7-6-12-20(22)23(27-24)16-8-2-1-3-9-16;1-19(2)20(3,4)25-21(24-19)18-22-16-13-9-8-12-15(16)17(23-18)14-10-6-5-7-11-14;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-15H;5-13H,1-4H3;1-6H |
| InChIKey | LDHYDPZLNGMMGC-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.48 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|