C39H28N4O2Si — CID 159328540
2-[5-methyl-3,7-bis(3-pyridin-2-ylphenoxy)benzo[b][1]benzosilol-5-yl]pyrimidine (PubChem CID 159328540) has the molecular formula C39H28N4O2Si and a molecular weight of 612.77 g/mol. Its IUPAC name is 2-[5-methyl-3,7-bis(3-pyridin-2-ylphenoxy)benzo[b][1]benzosilol-5-yl]pyrimidine.
| Compound Name | 2-[5-methyl-3,7-bis(3-pyridin-2-ylphenoxy)benzo[b][1]benzosilol-5-yl]pyrimidine |
|---|---|
| PubChem CID | 159328540 |
| Molecular Formula | C39H28N4O2Si |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-[5-methyl-3,7-bis(3-pyridin-2-ylphenoxy)benzo[b][1]benzosilol-5-yl]pyrimidine |
| SMILES | C[Si]1(c2ncccn2)c2cc(Oc3cccc(-c4ccccn4)c3)ccc2-c2ccc(Oc3cccc(-c4ccccn4)c3)cc21 |
| InChI | InChI=1S/C39H28N4O2Si/c1-46(39-42-21-8-22-43-39)37-25-31(44-29-11-6-9-27(23-29)35-13-2-4-19-40-35)15-17-33(37)34-18-16-32(26-38(34)46)45-30-12-7-10-28(24-30)36-14-3-5-20-41-36/h2-26H,1H3 |
| InChIKey | NHDWGXFCLGJPLY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|