About iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium
iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium (PubChem CID 159329174) has the molecular formula C6H13IN2+2
and a molecular weight of 240.09 g/mol. Its IUPAC name is iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium.
Molecular Properties
| Compound Name | iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium |
| PubChem CID | 159329174 |
| Molecular Formula | C6H13IN2+2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium |
| SMILES | CCC1=NC=C[NH+]1C.[IH2+] |
| InChI | InChI=1S/C6H10N2.H2I/c1-3-6-7-4-5-8(6)2;/h4-5H,3H2,1-2H3;1H2/q;+1/p+1 |
| InChIKey | RNRUUDPGGJIJBE-UHFFFAOYSA-O |
| XLogP | -3.74 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium?
The IUPAC name of iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium (CID 159329174) is iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium.
What is the SMILES notation for iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium?
The canonical SMILES for iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium is CCC1=NC=C[NH+]1C.[IH2+].
What is the InChIKey of iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium?
The InChIKey is RNRUUDPGGJIJBE-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H10N2.H2I/c1-3-6-7-4-5-8(6)2;/h4-5H,3H2,1-2H3;1H2/q;+1/p+1.
What are the key properties of iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium?
iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium has a molecular weight of 240.09 g/mol, XLogP of -3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodanium 2-ethyl-1-methyl-1H-imidazol-1-ium is sourced from PubChem (CID 159329174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).