C9H16N4+4 — CID 20776929
3-methyl-2-[(3-methyl-1H-imidazole-1,3-diium-2-yl)methyl]-1H-imidazole-1,3-diium (PubChem CID 20776929) has the molecular formula C9H16N4+4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-methyl-2-[(3-methyl-1H-imidazole-1,3-diium-2-yl)methyl]-1H-imidazole-1,3-diium.
| Compound Name | 3-methyl-2-[(3-methyl-1H-imidazole-1,3-diium-2-yl)methyl]-1H-imidazole-1,3-diium |
|---|---|
| PubChem CID | 20776929 |
| Molecular Formula | C9H16N4+4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-methyl-2-[(3-methyl-1H-imidazole-1,3-diium-2-yl)methyl]-1H-imidazole-1,3-diium |
| SMILES | C[N+]1=C(CC2=[N+](C)C=C[NH2+]2)[NH2+]C=C1 |
| InChI | InChI=1S/C9H12N4/c1-12-5-3-10-8(12)7-9-11-4-6-13(9)2/h3-6H,7H2,1-2H3/p+4 |
| InChIKey | AXJPGQWLRSRHIW-UHFFFAOYSA-R |
| XLogP | -2.45 |
| TPSA | 39.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|