C13H24N4 — CID 123260106
N'-[(Z)-2-[butyl(methyl)amino]ethenyl]-N-ethenyl-2-ethyliminoethanimidamide (PubChem CID 123260106) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-[(Z)-2-[butyl(methyl)amino]ethenyl]-N-ethenyl-2-ethyliminoethanimidamide.
| Compound Name | N'-[(Z)-2-[butyl(methyl)amino]ethenyl]-N-ethenyl-2-ethyliminoethanimidamide |
|---|---|
| PubChem CID | 123260106 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N'-[(Z)-2-[butyl(methyl)amino]ethenyl]-N-ethenyl-2-ethyliminoethanimidamide |
| SMILES | C=CNC(/C=N/CC)=N\C=C/N(C)CCCC |
| InChI | InChI=1S/C13H24N4/c1-5-8-10-17(4)11-9-16-13(15-7-3)12-14-6-2/h7,9,11-12H,3,5-6,8,10H2,1-2,4H3,(H,15,16)/b11-9-,14-12+ |
| InChIKey | RHCJSMGXJPBTTH-ZUJJVJDASA-N |
| XLogP | 2.41 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|