About ethane;N-ethenyl-N'-methylethanimidamide;propane
ethane;N-ethenyl-N'-methylethanimidamide;propane (PubChem CID 176961852) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is ethane;N-ethenyl-N'-methylethanimidamide;propane.
Molecular Properties
| Compound Name | ethane;N-ethenyl-N'-methylethanimidamide;propane |
| PubChem CID | 176961852 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | ethane;N-ethenyl-N'-methylethanimidamide;propane |
| SMILES | C=CN/C(C)=N/C.CC.CCC |
| InChI | InChI=1S/C5H10N2.C3H8.C2H6/c1-4-7-5(2)6-3;1-3-2;1-2/h4H,1H2,2-3H3,(H,6,7);3H2,1-2H3;1-2H3 |
| InChIKey | RWZIURIJXPBYPR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethenyl-N'-methylethanimidamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethenyl-N'-methylethanimidamide;propane?
The IUPAC name of ethane;N-ethenyl-N'-methylethanimidamide;propane (CID 176961852) is ethane;N-ethenyl-N'-methylethanimidamide;propane.
What is the SMILES notation for ethane;N-ethenyl-N'-methylethanimidamide;propane?
The canonical SMILES for ethane;N-ethenyl-N'-methylethanimidamide;propane is C=CN/C(C)=N/C.CC.CCC.
What is the InChIKey of ethane;N-ethenyl-N'-methylethanimidamide;propane?
The InChIKey is RWZIURIJXPBYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.C3H8.C2H6/c1-4-7-5(2)6-3;1-3-2;1-2/h4H,1H2,2-3H3,(H,6,7);3H2,1-2H3;1-2H3.
What are the key properties of ethane;N-ethenyl-N'-methylethanimidamide;propane?
ethane;N-ethenyl-N'-methylethanimidamide;propane has a molecular weight of 172.32 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethenyl-N'-methylethanimidamide;propane is sourced from PubChem (CID 176961852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).