1,2-dimethyl-1H-imidazol-1-ium iodide

C5H9IN2 — CID 67060368

IUPAC1,2-dimethyl-1H-imidazol-1-ium iodide
SMILESCC1=NC=C[NH+]1C.[I-]
InChIInChI=1S/C5H8N2.HI/c1-5-6-3-4-7(5)2;/h3-4H,1-2H3;1H
InChIKeyNHCGQHAZAQDUDS-UHFFFAOYSA-N
MW224.05 g/mol
LogP-3.59
Rot. Bonds

About 1,2-dimethyl-1H-imidazol-1-ium iodide

1,2-dimethyl-1H-imidazol-1-ium iodide (PubChem CID 67060368) has the molecular formula C5H9IN2 and a molecular weight of 224.05 g/mol. Its IUPAC name is 1,2-dimethyl-1H-imidazol-1-ium iodide.

Molecular Properties

Compound Name1,2-dimethyl-1H-imidazol-1-ium iodide
PubChem CID67060368
Molecular FormulaC5H9IN2
Molecular Weight224.05 g/mol
Exact Mass223.98
IUPAC Name1,2-dimethyl-1H-imidazol-1-ium iodide
SMILESCC1=NC=C[NH+]1C.[I-]
InChIInChI=1S/C5H8N2.HI/c1-5-6-3-4-7(5)2;/h3-4H,1-2H3;1H
InChIKeyNHCGQHAZAQDUDS-UHFFFAOYSA-N
XLogP-3.59
TPSA16.80 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.05
LogP ≤ 5-3.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 1,2-dimethyl-1H-imidazol-1-ium iodide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dimethyl-1H-imidazol-1-ium iodide?
The IUPAC name of 1,2-dimethyl-1H-imidazol-1-ium iodide (CID 67060368) is 1,2-dimethyl-1H-imidazol-1-ium iodide.
What is the SMILES notation for 1,2-dimethyl-1H-imidazol-1-ium iodide?
The canonical SMILES for 1,2-dimethyl-1H-imidazol-1-ium iodide is CC1=NC=C[NH+]1C.[I-].
What is the InChIKey of 1,2-dimethyl-1H-imidazol-1-ium iodide?
The InChIKey is NHCGQHAZAQDUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.HI/c1-5-6-3-4-7(5)2;/h3-4H,1-2H3;1H.
What are the key properties of 1,2-dimethyl-1H-imidazol-1-ium iodide?
1,2-dimethyl-1H-imidazol-1-ium iodide has a molecular weight of 224.05 g/mol, XLogP of -3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-1H-imidazol-1-ium iodide is sourced from PubChem (CID 67060368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).