About N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine
N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine (PubChem CID 142918277) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine.
Molecular Properties
| Compound Name | N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine |
| PubChem CID | 142918277 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine |
| SMILES | C=C/N=C(N)/C=N/C.CCNC |
| InChI | InChI=1S/C5H9N3.C3H9N/c1-3-8-5(6)4-7-2;1-3-4-2/h3-4H,1H2,2H3,(H2,6,8);4H,3H2,1-2H3/b7-4+; |
| InChIKey | OTJWXKQAGVSAOT-KQGICBIGSA-N |
| XLogP | 0.41 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine?
The IUPAC name of N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine (CID 142918277) is N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine.
What is the SMILES notation for N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine?
The canonical SMILES for N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine is C=C/N=C(N)/C=N/C.CCNC.
What is the InChIKey of N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine?
The InChIKey is OTJWXKQAGVSAOT-KQGICBIGSA-N. The full InChI is InChI=1S/C5H9N3.C3H9N/c1-3-8-5(6)4-7-2;1-3-4-2/h3-4H,1H2,2H3,(H2,6,8);4H,3H2,1-2H3/b7-4+;.
What are the key properties of N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine?
N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine has a molecular weight of 170.26 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-2-methyliminoethanimidamide;N-methylethanamine is sourced from PubChem (CID 142918277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).