C15H27N3O5 — CID 159332078
2-[2-[(2-amino-5-oxooctanoyl)amino]propanoylamino]butanoic acid (PubChem CID 159332078) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[2-[(2-amino-5-oxooctanoyl)amino]propanoylamino]butanoic acid.
| Compound Name | 2-[2-[(2-amino-5-oxooctanoyl)amino]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 159332078 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[2-[(2-amino-5-oxooctanoyl)amino]propanoylamino]butanoic acid |
| SMILES | CCCC(=O)CCC(N)C(=O)NC(C)C(=O)NC(CC)C(=O)O |
| InChI | InChI=1S/C15H27N3O5/c1-4-6-10(19)7-8-11(16)14(21)17-9(3)13(20)18-12(5-2)15(22)23/h9,11-12H,4-8,16H2,1-3H3,(H,17,21)(H,18,20)(H,22,23) |
| InChIKey | XYEVZWFVIIZLSL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |