C14H25N3O5S — CID 160834902
(2R)-2-[[(2S)-2-[(2-amino-5-oxooctanoyl)amino]propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 160834902) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[(2-amino-5-oxooctanoyl)amino]propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[(2-amino-5-oxooctanoyl)amino]propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 160834902 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2R)-2-[[(2S)-2-[(2-amino-5-oxooctanoyl)amino]propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCCC(=O)CCC(N)C(=O)N[C@@H](C)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C14H25N3O5S/c1-3-4-9(18)5-6-10(15)13(20)16-8(2)12(19)17-11(7-23)14(21)22/h8,10-11,23H,3-7,15H2,1-2H3,(H,16,20)(H,17,19)(H,21,22)/t8-,10?,11-/m0/s1 |
| InChIKey | VYCAGEAWALDGHV-ZWTOGROKSA-N |
| XLogP | -0.53 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|