C23H22O10 — CID 159338069
phenyl 2,3,4-trihydroxybenzoate;propyl 3,4,5-trihydroxybenzoate (PubChem CID 159338069) has the molecular formula C23H22O10 and a molecular weight of 458.42 g/mol. Its IUPAC name is phenyl 2,3,4-trihydroxybenzoate;propyl 3,4,5-trihydroxybenzoate.
| Compound Name | phenyl 2,3,4-trihydroxybenzoate;propyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 159338069 |
| Molecular Formula | C23H22O10 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | phenyl 2,3,4-trihydroxybenzoate;propyl 3,4,5-trihydroxybenzoate |
| SMILES | CCCOC(=O)c1cc(O)c(O)c(O)c1.O=C(Oc1ccccc1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C13H10O5.C10H12O5/c14-10-7-6-9(11(15)12(10)16)13(17)18-8-4-2-1-3-5-8;1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h1-7,14-16H;4-5,11-13H,2-3H2,1H3 |
| InChIKey | LFUIVOCIMSGUQF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|