C20H34O6S3 — CID 159341059
2-(2-carboxypropan-2-ylsulfanylcarbothioylsulfanyl)-2-methylpropanoic acid;2-ethylhexyl prop-2-enoate (PubChem CID 159341059) has the molecular formula C20H34O6S3 and a molecular weight of 466.69 g/mol. Its IUPAC name is 2-(2-carboxypropan-2-ylsulfanylcarbothioylsulfanyl)-2-methylpropanoic acid;2-ethylhexyl prop-2-enoate.
| Compound Name | 2-(2-carboxypropan-2-ylsulfanylcarbothioylsulfanyl)-2-methylpropanoic acid;2-ethylhexyl prop-2-enoate |
|---|---|
| PubChem CID | 159341059 |
| Molecular Formula | C20H34O6S3 |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-(2-carboxypropan-2-ylsulfanylcarbothioylsulfanyl)-2-methylpropanoic acid;2-ethylhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC)CCCC.CC(C)(SC(=S)SC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20O2.C9H14O4S3/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-8(2,5(10)11)15-7(14)16-9(3,4)6(12)13/h6,10H,3-5,7-9H2,1-2H3;1-4H3,(H,10,11)(H,12,13) |
| InChIKey | LGDKRTGQANSDAY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|