CH22O8Si9 — CID 159341702
bis(silyloxysilyloxy)silane;2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 159341702) has the molecular formula CH22O8Si9 and a molecular weight of 414.95 g/mol. Its IUPAC name is bis(silyloxysilyloxy)silane;2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | bis(silyloxysilyloxy)silane;2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 159341702 |
| Molecular Formula | CH22O8Si9 |
| Molecular Weight | 414.95 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | bis(silyloxysilyloxy)silane;2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH2]O[SiH2]O[SiH2]O1.[SiH3]O[SiH2]O[SiH2]O[SiH2]O[SiH3] |
| InChI | InChI=1S/CH10O4Si4.H12O4Si5/c1-9-4-7-2-6-3-8-5-9;5-1-7-3-9-4-8-2-6/h9H,6-8H2,1H3;7-9H2,5-6H3 |
| InChIKey | LGFKKLXXOISCDW-UHFFFAOYSA-N |
| XLogP | -8.48 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.95 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|