C22H34N2O7 — CID 159345911
(2S)-5-amino-2-(hydroxymethyl)-6-(4-hydroxyphenyl)-4-oxo-N-[2-[2-(2-oxopentoxy)ethoxy]ethyl]hexanamide (PubChem CID 159345911) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is (2S)-5-amino-2-(hydroxymethyl)-6-(4-hydroxyphenyl)-4-oxo-N-[2-[2-(2-oxopentoxy)ethoxy]ethyl]hexanamide.
| Compound Name | (2S)-5-amino-2-(hydroxymethyl)-6-(4-hydroxyphenyl)-4-oxo-N-[2-[2-(2-oxopentoxy)ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 159345911 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (2S)-5-amino-2-(hydroxymethyl)-6-(4-hydroxyphenyl)-4-oxo-N-[2-[2-(2-oxopentoxy)ethoxy]ethyl]hexanamide |
| SMILES | CCCC(=O)COCCOCCNC(=O)[C@H](CO)CC(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H34N2O7/c1-2-3-19(27)15-31-11-10-30-9-8-24-22(29)17(14-25)13-21(28)20(23)12-16-4-6-18(26)7-5-16/h4-7,17,20,25-26H,2-3,8-15,23H2,1H3,(H,24,29)/t17-,20?/m0/s1 |
| InChIKey | XERFMEQXJPZZKI-DIMJTDRSSA-N |
| XLogP | 0.35 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|