C31H46N5O8 — CID 59576396
CID 59576396 (PubChem CID 59576396) has the molecular formula C31H46N5O8 and a molecular weight of 616.74 g/mol.
| Compound Name | CID 59576396 |
|---|---|
| PubChem CID | 59576396 |
| Molecular Formula | C31H46N5O8 |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | — |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@@H](N)CCCCCC(=O)COCCOCCNC(=O)[C@H](CO)CC(=O)[C@@H]([NH])Cc1ccc(O)cc1 |
| InChI | InChI=1S/C31H46N5O8/c32-19-24-5-4-13-36(24)31(42)27(33)7-3-1-2-6-26(39)21-44-16-15-43-14-12-35-30(41)23(20-37)18-29(40)28(34)17-22-8-10-25(38)11-9-22/h8-11,23-24,27-28,34,37-38H,1-7,12-18,20-21,33H2,(H,35,41)/t23-,24-,27-,28-/m0/s1 |
| InChIKey | BGOVYPKPRJEMOK-LSGCGUROSA-N |
| XLogP | 0.66 |
| TPSA | 216.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|