C22H20F3NO4S2 — CID 159347975
N-ethoxy-3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]-4-thiophen-3-ylbenzenesulfonamide (PubChem CID 159347975) has the molecular formula C22H20F3NO4S2 and a molecular weight of 483.53 g/mol. Its IUPAC name is N-ethoxy-3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]-4-thiophen-3-ylbenzenesulfonamide.
| Compound Name | N-ethoxy-3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]-4-thiophen-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 159347975 |
| Molecular Formula | C22H20F3NO4S2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-ethoxy-3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]-4-thiophen-3-ylbenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1ccc(-c2ccsc2)c(CC(=O)Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H20F3NO4S2/c1-2-30-26-32(28,29)20-6-7-21(16-8-9-31-14-16)17(13-20)12-19(27)11-15-4-3-5-18(10-15)22(23,24)25/h3-10,13-14,26H,2,11-12H2,1H3 |
| InChIKey | LGYRQUFUOCTECX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|