C22H15F6NO — CID 159357605
9-[2,4-bis(trifluoromethyl)phenyl]-3-methoxy-6-methylcarbazole (PubChem CID 159357605) has the molecular formula C22H15F6NO and a molecular weight of 423.36 g/mol. Its IUPAC name is 9-[2,4-bis(trifluoromethyl)phenyl]-3-methoxy-6-methylcarbazole.
| Compound Name | 9-[2,4-bis(trifluoromethyl)phenyl]-3-methoxy-6-methylcarbazole |
|---|---|
| PubChem CID | 159357605 |
| Molecular Formula | C22H15F6NO |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 9-[2,4-bis(trifluoromethyl)phenyl]-3-methoxy-6-methylcarbazole |
| SMILES | COc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H15F6NO/c1-12-3-6-18-15(9-12)16-11-14(30-2)5-8-19(16)29(18)20-7-4-13(21(23,24)25)10-17(20)22(26,27)28/h3-11H,1-2H3 |
| InChIKey | LICWAQGTBFEXSA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |