C22H15F3N2O — CID 149290836
4-(3-methoxy-6-methylcarbazol-9-yl)-3-(trifluoromethyl)benzonitrile (PubChem CID 149290836) has the molecular formula C22H15F3N2O and a molecular weight of 380.37 g/mol. Its IUPAC name is 4-(3-methoxy-6-methylcarbazol-9-yl)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-methoxy-6-methylcarbazol-9-yl)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 149290836 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-(3-methoxy-6-methylcarbazol-9-yl)-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C22H15F3N2O/c1-13-3-6-19-16(9-13)17-11-15(28-2)5-8-20(17)27(19)21-7-4-14(12-26)10-18(21)22(23,24)25/h3-11H,1-2H3 |
| InChIKey | XUUPWVLZQADWNG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |