C22H23N5O2S — CID 159360880
N-(6-amino-4-ethyl-3H-indol-2-yl)-4-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]butanamide (PubChem CID 159360880) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-(6-amino-4-ethyl-3H-indol-2-yl)-4-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]butanamide.
| Compound Name | N-(6-amino-4-ethyl-3H-indol-2-yl)-4-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 159360880 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(6-amino-4-ethyl-3H-indol-2-yl)-4-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]butanamide |
| SMILES | CCc1cc(N)cc2c1CC(NC(=O)CCCSc1nc3ccccc3c(=O)[nH]1)=N2 |
| InChI | InChI=1S/C22H23N5O2S/c1-2-13-10-14(23)11-18-16(13)12-19(24-18)26-20(28)8-5-9-30-22-25-17-7-4-3-6-15(17)21(29)27-22/h3-4,6-7,10-11H,2,5,8-9,12,23H2,1H3,(H,24,26,28)(H,25,27,29) |
| InChIKey | ICKHEXFHBAFPTI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|