C27H20F5NO4 — CID 159365610
aniline;2-benzyl-3,4-difluorobenzoic acid;2,3,4-trifluorobenzoic acid (PubChem CID 159365610) has the molecular formula C27H20F5NO4 and a molecular weight of 517.45 g/mol. Its IUPAC name is aniline;2-benzyl-3,4-difluorobenzoic acid;2,3,4-trifluorobenzoic acid.
| Compound Name | aniline;2-benzyl-3,4-difluorobenzoic acid;2,3,4-trifluorobenzoic acid |
|---|---|
| PubChem CID | 159365610 |
| Molecular Formula | C27H20F5NO4 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | aniline;2-benzyl-3,4-difluorobenzoic acid;2,3,4-trifluorobenzoic acid |
| SMILES | Nc1ccccc1.O=C(O)c1ccc(F)c(F)c1Cc1ccccc1.O=C(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F2O2.C7H3F3O2.C6H7N/c15-12-7-6-10(14(17)18)11(13(12)16)8-9-4-2-1-3-5-9;8-4-2-1-3(7(11)12)5(9)6(4)10;7-6-4-2-1-3-5-6/h1-7H,8H2,(H,17,18);1-2H,(H,11,12);1-5H,7H2 |
| InChIKey | LJCAJFYPEKSYQM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|