About bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine
bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine (PubChem CID 174304693) has the molecular formula C27H22F4N2O
and a molecular weight of 466.48 g/mol. Its IUPAC name is bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine.
Molecular Properties
| Compound Name | bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine |
| PubChem CID | 174304693 |
| Molecular Formula | C27H22F4N2O |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine |
| SMILES | NN.O=C(c1ccc(F)c(F)c1Cc1ccccc1)c1ccc(F)c(F)c1Cc1ccccc1 |
| InChI | InChI=1S/C27H18F4O.H4N2/c28-23-13-11-19(21(25(23)30)15-17-7-3-1-4-8-17)27(32)20-12-14-24(29)26(31)22(20)16-18-9-5-2-6-10-18;1-2/h1-14H,15-16H2;1-2H2 |
| InChIKey | LVBUFMSJNPSAMW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine?
The IUPAC name of bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine (CID 174304693) is bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine.
What is the SMILES notation for bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine?
The canonical SMILES for bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine is NN.O=C(c1ccc(F)c(F)c1Cc1ccccc1)c1ccc(F)c(F)c1Cc1ccccc1.
What is the InChIKey of bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine?
The InChIKey is LVBUFMSJNPSAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18F4O.H4N2/c28-23-13-11-19(21(25(23)30)15-17-7-3-1-4-8-17)27(32)20-12-14-24(29)26(31)22(20)16-18-9-5-2-6-10-18;1-2/h1-14H,15-16H2;1-2H2.
What are the key properties of bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine?
bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine has a molecular weight of 466.48 g/mol, XLogP of 5.47, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-benzyl-3,4-difluorophenyl)methanone;hydrazine is sourced from PubChem (CID 174304693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).