C19H38O3Si — CID 15936697
cyclohexyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 15936697) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is cyclohexyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-4,4-dimethylpentanoate.
| Compound Name | cyclohexyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 15936697 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | cyclohexyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)[C@H](O)[C@H](C(=O)OC1CCCCC1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-18(2,3)16(20)15(23(7,8)19(4,5)6)17(21)22-14-12-10-9-11-13-14/h14-16,20H,9-13H2,1-8H3/t15-,16-/m1/s1 |
| InChIKey | JCGUKPRBKWSVEH-HZPDHXFCSA-N |
| XLogP | 5.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|