C15H32O4Si — CID 11231989
methyl (3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylhexanoate (PubChem CID 11231989) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is methyl (3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylhexanoate.
| Compound Name | methyl (3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 11231989 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | methyl (3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)[C@H](O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-14(2,3)20(7,8)19-11-9-10-12(16)15(4,5)13(17)18-6/h12,16H,9-11H2,1-8H3/t12-/m1/s1 |
| InChIKey | HGUSTXRUDQUCGD-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|