C17H34O5Si — CID 91132868
(3R)-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethylpentanedioic acid (PubChem CID 91132868) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (3R)-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethylpentanedioic acid.
| Compound Name | (3R)-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethylpentanedioic acid |
|---|---|
| PubChem CID | 91132868 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3R)-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethylpentanedioic acid |
| SMILES | CCC(C(=O)O)([C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-10-17(14(20)21,15(2,3)4)12(11-13(18)19)22-23(8,9)16(5,6)7/h12H,10-11H2,1-9H3,(H,18,19)(H,20,21)/t12-,17?/m1/s1 |
| InChIKey | SGMJWJPRQNTMCL-MTATWXBHSA-N |
| XLogP | 4.38 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|