C18H38O5Si2 — CID 141379495
(2R)-2-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanedioic acid (PubChem CID 141379495) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanedioic acid.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanedioic acid |
|---|---|
| PubChem CID | 141379495 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(=O)O)[C@](C)(C(=O)O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si2/c1-16(2,3)24(8,9)18(7,15(21)22)13(12-14(19)20)23-25(10,11)17(4,5)6/h13H,12H2,1-11H3,(H,19,20)(H,21,22)/t13?,18-/m1/s1 |
| InChIKey | LQJCBTLMCAFSAW-PQJIZZRHSA-N |
| XLogP | 5.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|