C18H38O5Si2 — CID 91697368
bis[tert-butyl(dimethyl)silyl] 3-hydroxy-3-methylpentanedioate (PubChem CID 91697368) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 3-hydroxy-3-methylpentanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 3-hydroxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 91697368 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 3-hydroxy-3-methylpentanedioate |
| SMILES | CC(O)(CC(=O)O[Si](C)(C)C(C)(C)C)CC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si2/c1-16(2,3)24(8,9)22-14(19)12-18(7,21)13-15(20)23-25(10,11)17(4,5)6/h21H,12-13H2,1-11H3 |
| InChIKey | JPROPNQQIFBCQY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|