C18H34O9Si2 — CID 59128085
3-[2-[[[4-carboxy-3-(carboxymethyl)butyl]-dimethylsilyl]oxy-dimethylsilyl]ethyl]pentanedioic acid (PubChem CID 59128085) has the molecular formula C18H34O9Si2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-[2-[[[4-carboxy-3-(carboxymethyl)butyl]-dimethylsilyl]oxy-dimethylsilyl]ethyl]pentanedioic acid.
| Compound Name | 3-[2-[[[4-carboxy-3-(carboxymethyl)butyl]-dimethylsilyl]oxy-dimethylsilyl]ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 59128085 |
| Molecular Formula | C18H34O9Si2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-[2-[[[4-carboxy-3-(carboxymethyl)butyl]-dimethylsilyl]oxy-dimethylsilyl]ethyl]pentanedioic acid |
| SMILES | C[Si](C)(CCC(CC(=O)O)CC(=O)O)O[Si](C)(C)CCC(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C18H34O9Si2/c1-28(2,7-5-13(9-15(19)20)10-16(21)22)27-29(3,4)8-6-14(11-17(23)24)12-18(25)26/h13-14H,5-12H2,1-4H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | LMUDNTJEZIRSCB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|